C23H25NO — CID 68943364
(5Z)-5-butylidene-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline (PubChem CID 68943364) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (5Z)-5-butylidene-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline.
| Compound Name | (5Z)-5-butylidene-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 68943364 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (5Z)-5-butylidene-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
| SMILES | CCC/C=C1\Oc2ccccc2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C23H25NO/c1-5-6-10-20-22-17(16-9-7-8-11-19(16)25-20)12-13-18-21(22)15(2)14-23(3,4)24-18/h7-14,24H,5-6H2,1-4H3/b20-10- |
| InChIKey | LCLAWSWZRIMAPF-JMIUGGIZSA-N |
| XLogP | 6.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |