C26H20ClF2NO — CID 69417493
5-[(2-chlorophenyl)methylidene]-7,9-difluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline (PubChem CID 69417493) has the molecular formula C26H20ClF2NO and a molecular weight of 435.90 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylidene]-7,9-difluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline.
| Compound Name | 5-[(2-chlorophenyl)methylidene]-7,9-difluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 69417493 |
| Molecular Formula | C26H20ClF2NO |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 5-[(2-chlorophenyl)methylidene]-7,9-difluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)C(=Cc1ccccc1Cl)Oc1c(F)cc(F)cc1-3 |
| InChI | InChI=1S/C26H20ClF2NO/c1-14-13-26(2,3)30-21-9-8-17-18-11-16(28)12-20(29)25(18)31-22(24(17)23(14)21)10-15-6-4-5-7-19(15)27/h4-13,30H,1-3H3 |
| InChIKey | VOPCEQXXVWFFAU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|