C27H29F2NO — CID 44560815
(5S)-5-[(1S)-2,3-dimethylcyclohex-2-en-1-yl]-7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 44560815) has the molecular formula C27H29F2NO and a molecular weight of 421.53 g/mol. Its IUPAC name is (5S)-5-[(1S)-2,3-dimethylcyclohex-2-en-1-yl]-7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | (5S)-5-[(1S)-2,3-dimethylcyclohex-2-en-1-yl]-7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 44560815 |
| Molecular Formula | C27H29F2NO |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | (5S)-5-[(1S)-2,3-dimethylcyclohex-2-en-1-yl]-7,9-difluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)[C@H]([C@H]1CCCC(C)=C1C)Oc1c(F)cc(F)cc1-3 |
| InChI | InChI=1S/C27H29F2NO/c1-14-7-6-8-18(16(14)3)26-24-19(20-11-17(28)12-21(29)25(20)31-26)9-10-22-23(24)15(2)13-27(4,5)30-22/h9-13,18,26,30H,6-8H2,1-5H3/t18-,26-/m0/s1 |
| InChIKey | KSNTUZZVDDRCSZ-QYBDOPJKSA-N |
| XLogP | 7.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|