C19H18FNO2 — CID 54332276
8-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-ol (PubChem CID 54332276) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 8-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-ol.
| Compound Name | 8-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-ol |
|---|---|
| PubChem CID | 54332276 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 8-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinolin-5-ol |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)C(O)Oc1cc(F)ccc1-3 |
| InChI | InChI=1S/C19H18FNO2/c1-10-9-19(2,3)21-14-7-6-13-12-5-4-11(20)8-15(12)23-18(22)17(13)16(10)14/h4-9,18,21-22H,1-3H3 |
| InChIKey | SZEDTVQTSFQAGZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |