C27H30FNO — CID 10341139
5-(3-ethylcyclohex-2-en-1-yl)-9-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10341139) has the molecular formula C27H30FNO and a molecular weight of 403.54 g/mol. Its IUPAC name is 5-(3-ethylcyclohex-2-en-1-yl)-9-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 5-(3-ethylcyclohex-2-en-1-yl)-9-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10341139 |
| Molecular Formula | C27H30FNO |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 5-(3-ethylcyclohex-2-en-1-yl)-9-fluoro-2,2,4-trimethyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CCC1=CC(C2Oc3ccc(F)cc3-c3ccc4c(c32)C(C)=CC(C)(C)N4)CCC1 |
| InChI | InChI=1S/C27H30FNO/c1-5-17-7-6-8-18(13-17)26-25-20(21-14-19(28)9-12-23(21)30-26)10-11-22-24(25)16(2)15-27(3,4)29-22/h9-15,18,26,29H,5-8H2,1-4H3 |
| InChIKey | VNAHRFLJZYRVND-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|