C36H38O5S — CID 100990503
2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde (PubChem CID 100990503) has the molecular formula C36H38O5S and a molecular weight of 582.76 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 100990503 |
| Molecular Formula | C36H38O5S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetaldehyde |
| SMILES | Cc1ccc(S[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C36H38O5S/c1-27-17-19-31(20-18-27)42-36-32(21-22-37)41-33(26-38-23-28-11-5-2-6-12-28)34(39-24-29-13-7-3-8-14-29)35(36)40-25-30-15-9-4-10-16-30/h2-20,22,32-36H,21,23-26H2,1H3/t32-,33+,34+,35-,36-/m0/s1 |
| InChIKey | WKKBDSKSYQTKIP-PYHSBISQSA-N |
| XLogP | 7.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|