C33H32N2O6 — CID 10099120
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9-oxoxanthene-4-carboxamide (PubChem CID 10099120) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9-oxoxanthene-4-carboxamide.
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9-oxoxanthene-4-carboxamide |
|---|---|
| PubChem CID | 10099120 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]ethoxy]phenyl]-9-oxoxanthene-4-carboxamide |
| SMILES | COc1ccc(CCN(C)CCOc2ccc(NC(=O)c3cccc4c(=O)c5ccccc5oc34)cc2)cc1OC |
| InChI | InChI=1S/C33H32N2O6/c1-35(18-17-22-11-16-29(38-2)30(21-22)39-3)19-20-40-24-14-12-23(13-15-24)34-33(37)27-9-6-8-26-31(36)25-7-4-5-10-28(25)41-32(26)27/h4-16,21H,17-20H2,1-3H3,(H,34,37) |
| InChIKey | CBWZBPIGINMFPR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|