C8H16N2O4S — CID 100992171
(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-N-methylpiperidine-1-carbothioamide (PubChem CID 100992171) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-N-methylpiperidine-1-carbothioamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-N-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 100992171 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-N-methylpiperidine-1-carbothioamide |
| SMILES | CNC(=S)N1C[C@@H](O)[C@H](O)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C8H16N2O4S/c1-9-8(15)10-3-4(11)5(12)6(13)7(10)14-2/h4-7,11-13H,3H2,1-2H3,(H,9,15)/t4-,5+,6-,7-/m1/s1 |
| InChIKey | KLPUDPWRNXPDGF-XZBKPIIZSA-N |
| XLogP | -2.14 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|