C19H37NO6Si2 — CID 100995082
1-phenyl-N,N-bis(triethoxysilyl)methanamine (PubChem CID 100995082) has the molecular formula C19H37NO6Si2 and a molecular weight of 431.68 g/mol. Its IUPAC name is 1-phenyl-N,N-bis(triethoxysilyl)methanamine.
| Compound Name | 1-phenyl-N,N-bis(triethoxysilyl)methanamine |
|---|---|
| PubChem CID | 100995082 |
| Molecular Formula | C19H37NO6Si2 |
| Molecular Weight | 431.68 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-phenyl-N,N-bis(triethoxysilyl)methanamine |
| SMILES | CCO[Si](OCC)(OCC)N(Cc1ccccc1)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C19H37NO6Si2/c1-7-21-27(22-8-2,23-9-3)20(18-19-16-14-13-15-17-19)28(24-10-4,25-11-5)26-12-6/h13-17H,7-12,18H2,1-6H3 |
| InChIKey | ANIWRGHEGFPXES-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|