C17H20N4O6 — CID 100997571
3-amino-6-[(E)-2-phenylethenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2,4-triazin-5-one (PubChem CID 100997571) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is 3-amino-6-[(E)-2-phenylethenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2,4-triazin-5-one.
| Compound Name | 3-amino-6-[(E)-2-phenylethenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 100997571 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-amino-6-[(E)-2-phenylethenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,2,4-triazin-5-one |
| SMILES | Nc1nc(=O)c(/C=C/c2ccccc2)nn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H20N4O6/c18-17-19-15(26)10(7-6-9-4-2-1-3-5-9)20-21(17)16-14(25)13(24)12(23)11(8-22)27-16/h1-7,11-14,16,22-25H,8H2,(H2,18,19,26)/b7-6+/t11-,12-,13+,14-,16-/m1/s1 |
| InChIKey | KIAJAFYAURDYIO-KBZUNMJSSA-N |
| XLogP | -1.64 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |