About O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate
O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate (PubChem CID 100998038) has the molecular formula C16H26N2OS
and a molecular weight of 294.46 g/mol. Its IUPAC name is O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate |
| PubChem CID | 100998038 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate |
| SMILES | CN(CCCN(C)C(C)(C)C)C(=S)Oc1ccccc1 |
| InChI | InChI=1S/C16H26N2OS/c1-16(2,3)18(5)13-9-12-17(4)15(20)19-14-10-7-6-8-11-14/h6-8,10-11H,9,12-13H2,1-5H3 |
| InChIKey | XQAWPMFXQFPROX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate?
The IUPAC name of O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate (CID 100998038) is O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate.
What is the SMILES notation for O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate?
The canonical SMILES for O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate is CN(CCCN(C)C(C)(C)C)C(=S)Oc1ccccc1.
What is the InChIKey of O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate?
The InChIKey is XQAWPMFXQFPROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2OS/c1-16(2,3)18(5)13-9-12-17(4)15(20)19-14-10-7-6-8-11-14/h6-8,10-11H,9,12-13H2,1-5H3.
What are the key properties of O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate?
O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate has a molecular weight of 294.46 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl N-[3-[tert-butyl(methyl)amino]propyl]-N-methylcarbamothioate is sourced from PubChem (CID 100998038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).