C26H24N6S — CID 100998224
N,N-dimethyl-4-[10-(3-methylphenyl)-4-phenyl-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]aniline (PubChem CID 100998224) has the molecular formula C26H24N6S and a molecular weight of 452.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[10-(3-methylphenyl)-4-phenyl-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]aniline.
| Compound Name | N,N-dimethyl-4-[10-(3-methylphenyl)-4-phenyl-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]aniline |
|---|---|
| PubChem CID | 100998224 |
| Molecular Formula | C26H24N6S |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N,N-dimethyl-4-[10-(3-methylphenyl)-4-phenyl-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]aniline |
| SMILES | Cc1cccc(-c2nc3n(n2)C2=NN(c4ccccc4)C(c4ccc(N(C)C)cc4)C2S3)c1 |
| InChI | InChI=1S/C26H24N6S/c1-17-8-7-9-19(16-17)24-27-26-32(28-24)25-23(33-26)22(18-12-14-20(15-13-18)30(2)3)31(29-25)21-10-5-4-6-11-21/h4-16,22-23H,1-3H3 |
| InChIKey | DEYIOVSPBUHPEZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|