C26H22N8O4S — CID 100998223
4-[4-(2,4-dinitrophenyl)-10-(3-methylphenyl)-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]-N,N-dimethylaniline (PubChem CID 100998223) has the molecular formula C26H22N8O4S and a molecular weight of 542.58 g/mol. Its IUPAC name is 4-[4-(2,4-dinitrophenyl)-10-(3-methylphenyl)-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(2,4-dinitrophenyl)-10-(3-methylphenyl)-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 100998223 |
| Molecular Formula | C26H22N8O4S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 4-[4-(2,4-dinitrophenyl)-10-(3-methylphenyl)-7-thia-1,3,4,9,11-pentazatricyclo[6.3.0.02,6]undeca-2,8,10-trien-5-yl]-N,N-dimethylaniline |
| SMILES | Cc1cccc(-c2nc3n(n2)C2=NN(c4ccc([N+](=O)[O-])cc4[N+](=O)[O-])C(c4ccc(N(C)C)cc4)C2S3)c1 |
| InChI | InChI=1S/C26H22N8O4S/c1-15-5-4-6-17(13-15)24-27-26-32(28-24)25-23(39-26)22(16-7-9-18(10-8-16)30(2)3)31(29-25)20-12-11-19(33(35)36)14-21(20)34(37)38/h4-14,22-23H,1-3H3 |
| InChIKey | WBFPVLBAFDHXPU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 135.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|