C21H20N6O5S — CID 10671969
4-(2,4-dinitrophenyl)-5-(4-methoxyphenyl)-7-thia-1,3,4,9-tetrazatricyclo[6.5.0.02,6]trideca-2,8-diene (PubChem CID 10671969) has the molecular formula C21H20N6O5S and a molecular weight of 468.50 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)-5-(4-methoxyphenyl)-7-thia-1,3,4,9-tetrazatricyclo[6.5.0.02,6]trideca-2,8-diene.
| Compound Name | 4-(2,4-dinitrophenyl)-5-(4-methoxyphenyl)-7-thia-1,3,4,9-tetrazatricyclo[6.5.0.02,6]trideca-2,8-diene |
|---|---|
| PubChem CID | 10671969 |
| Molecular Formula | C21H20N6O5S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-(2,4-dinitrophenyl)-5-(4-methoxyphenyl)-7-thia-1,3,4,9-tetrazatricyclo[6.5.0.02,6]trideca-2,8-diene |
| SMILES | COc1ccc(C2C3SC4=NCCCCN4C3=NN2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N6O5S/c1-32-15-7-4-13(5-8-15)18-19-20(24-11-3-2-10-22-21(24)33-19)23-25(18)16-9-6-14(26(28)29)12-17(16)27(30)31/h4-9,12,18-19H,2-3,10-11H2,1H3 |
| InChIKey | WUNVGCYVBALOFI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 126.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|