C18H19ClN4O6 — CID 100999272
methyl 2-[5-[2-(2-chlorophenyl)ethyl-methylamino]-2,4-dinitroanilino]acetate (PubChem CID 100999272) has the molecular formula C18H19ClN4O6 and a molecular weight of 422.83 g/mol. Its IUPAC name is methyl 2-[5-[2-(2-chlorophenyl)ethyl-methylamino]-2,4-dinitroanilino]acetate.
| Compound Name | methyl 2-[5-[2-(2-chlorophenyl)ethyl-methylamino]-2,4-dinitroanilino]acetate |
|---|---|
| PubChem CID | 100999272 |
| Molecular Formula | C18H19ClN4O6 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | methyl 2-[5-[2-(2-chlorophenyl)ethyl-methylamino]-2,4-dinitroanilino]acetate |
| SMILES | COC(=O)CNc1cc(N(C)CCc2ccccc2Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19ClN4O6/c1-21(8-7-12-5-3-4-6-13(12)19)16-9-14(20-11-18(24)29-2)15(22(25)26)10-17(16)23(27)28/h3-6,9-10,20H,7-8,11H2,1-2H3 |
| InChIKey | YHSVSRBSOGBRGF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|