C21H42O5Si — CID 100999903
(2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(E)-prop-1-enyl]oxan-4-ol (PubChem CID 100999903) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(E)-prop-1-enyl]oxan-4-ol.
| Compound Name | (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(E)-prop-1-enyl]oxan-4-ol |
|---|---|
| PubChem CID | 100999903 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-2-methoxy-3,5-dimethyl-2-[(E)-prop-1-enyl]oxan-4-ol |
| SMILES | C/C=C/[C@]1(OC)O[C@H](C[C@H](COC)O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C21H42O5Si/c1-11-12-21(24-8)16(3)19(22)15(2)18(25-21)13-17(14-23-7)26-27(9,10)20(4,5)6/h11-12,15-19,22H,13-14H2,1-10H3/b12-11+/t15-,16+,17+,18+,19-,21-/m0/s1 |
| InChIKey | VEVWXLKGEWSOFS-VFBCFTQVSA-N |
| XLogP | 4.36 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|