C47H46O11 — CID 100999959
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3,5,5-trimethyl-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 100999959) has the molecular formula C47H46O11 and a molecular weight of 786.87 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3,5,5-trimethyl-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3,5,5-trimethyl-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 100999959 |
| Molecular Formula | C47H46O11 |
| Molecular Weight | 786.87 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-[3,5,5-trimethyl-4-[(E)-3-oxobut-1-enyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC(=O)/C=C/C1=C(C)CC(O[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C47H46O11/c1-30-27-36(28-47(3,4)37(30)26-25-31(2)48)54-46-41(58-45(52)35-23-15-8-16-24-35)40(57-44(51)34-21-13-7-14-22-34)39(56-43(50)33-19-11-6-12-20-33)38(55-46)29-53-42(49)32-17-9-5-10-18-32/h5-26,36,38-41,46H,27-29H2,1-4H3/b26-25+/t36?,38-,39-,40+,41-,46+/m1/s1 |
| InChIKey | MHHRWYNTMZUCKD-RSDBXBMWSA-N |
| XLogP | 7.91 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.87 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|