C49H48O11 — CID 10952892
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(1R)-3,5,5-trimethyl-4-[(1E,3E)-3-methyl-5-oxopenta-1,3-dienyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 10952892) has the molecular formula C49H48O11 and a molecular weight of 812.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(1R)-3,5,5-trimethyl-4-[(1E,3E)-3-methyl-5-oxopenta-1,3-dienyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(1R)-3,5,5-trimethyl-4-[(1E,3E)-3-methyl-5-oxopenta-1,3-dienyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10952892 |
| Molecular Formula | C49H48O11 |
| Molecular Weight | 812.91 g/mol |
| Exact Mass | 812.32 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[(1R)-3,5,5-trimethyl-4-[(1E,3E)-3-methyl-5-oxopenta-1,3-dienyl]cyclohex-3-en-1-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=O)C(C)(C)C[C@H](O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C49H48O11/c1-32(27-28-50)25-26-39-33(2)29-38(30-49(39,3)4)56-48-43(60-47(54)37-23-15-8-16-24-37)42(59-46(53)36-21-13-7-14-22-36)41(58-45(52)35-19-11-6-12-20-35)40(57-48)31-55-44(51)34-17-9-5-10-18-34/h5-28,38,40-43,48H,29-31H2,1-4H3/b26-25+,32-27+/t38-,40-,41-,42+,43-,48-/m1/s1 |
| InChIKey | MOACMBCEESIQTG-NXJIUBARSA-N |
| XLogP | 8.47 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.91 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|