C12H14N2O8 — CID 101000020
tetramethyl 1,4-dihydropyridazine-3,4,5,6-tetracarboxylate (PubChem CID 101000020) has the molecular formula C12H14N2O8 and a molecular weight of 314.25 g/mol. Its IUPAC name is tetramethyl 1,4-dihydropyridazine-3,4,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1,4-dihydropyridazine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 101000020 |
| Molecular Formula | C12H14N2O8 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | tetramethyl 1,4-dihydropyridazine-3,4,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=NNC(C(=O)OC)=C(C(=O)OC)C1C(=O)OC |
| InChI | InChI=1S/C12H14N2O8/c1-19-9(15)5-6(10(16)20-2)8(12(18)22-4)14-13-7(5)11(17)21-3/h5,14H,1-4H3 |
| InChIKey | RTOLTSUUCQMLMS-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|