About 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile
6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile (PubChem CID 101001060) has the molecular formula C22H13N5OS
and a molecular weight of 395.45 g/mol. Its IUPAC name is 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile |
| PubChem CID | 101001060 |
| Molecular Formula | C22H13N5OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(=O)c2ccccc2)c(N)nc1C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H13N5OS/c23-11-14-10-15(20(28)13-6-2-1-3-7-13)21(25)27-19(14)16(12-24)22-26-17-8-4-5-9-18(17)29-22/h1-10,16H,(H2,25,27) |
| InChIKey | ARMTWHNYEZCKPC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile?
The IUPAC name of 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile (CID 101001060) is 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile.
What is the SMILES notation for 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile?
The canonical SMILES for 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile is N#Cc1cc(C(=O)c2ccccc2)c(N)nc1C(C#N)c1nc2ccccc2s1.
What is the InChIKey of 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile?
The InChIKey is ARMTWHNYEZCKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N5OS/c23-11-14-10-15(20(28)13-6-2-1-3-7-13)21(25)27-19(14)16(12-24)22-26-17-8-4-5-9-18(17)29-22/h1-10,16H,(H2,25,27).
What are the key properties of 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile?
6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile has a molecular weight of 395.45 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-[1,3-benzothiazol-2-yl(cyano)methyl]-5-benzoylpyridine-3-carbonitrile is sourced from PubChem (CID 101001060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).