C16H10N4O2S — CID 101494718
4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid (PubChem CID 101494718) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid.
| Compound Name | 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 101494718 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid |
| SMILES | N#CC(/N=N/c1ccc(C(=O)O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H10N4O2S/c17-9-13(15-18-12-3-1-2-4-14(12)23-15)20-19-11-7-5-10(6-8-11)16(21)22/h1-8,13H,(H,21,22)/b20-19+ |
| InChIKey | WXFJSIPCGHFAKE-FMQUCBEESA-N |
| XLogP | 4.34 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|