4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid

C16H10N4O2S — CID 101494718

IUPAC4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid
SMILESN#CC(/N=N/c1ccc(C(=O)O)cc1)c1nc2ccccc2s1
InChIInChI=1S/C16H10N4O2S/c17-9-13(15-18-12-3-1-2-4-14(12)23-15)20-19-11-7-5-10(6-8-11)16(21)22/h1-8,13H,(H,21,22)/b20-19+
InChIKeyWXFJSIPCGHFAKE-FMQUCBEESA-N
MW322.35 g/mol
LogP4.34
Rot. Bonds4

About 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid

4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid (PubChem CID 101494718) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid.

Molecular Properties

Compound Name4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid
PubChem CID101494718
Molecular FormulaC16H10N4O2S
Molecular Weight322.35 g/mol
Exact Mass322.05
IUPAC Name4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid
SMILESN#CC(/N=N/c1ccc(C(=O)O)cc1)c1nc2ccccc2s1
InChIInChI=1S/C16H10N4O2S/c17-9-13(15-18-12-3-1-2-4-14(12)23-15)20-19-11-7-5-10(6-8-11)16(21)22/h1-8,13H,(H,21,22)/b20-19+
InChIKeyWXFJSIPCGHFAKE-FMQUCBEESA-N
XLogP4.34
TPSA98.70 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.35
LogP ≤ 54.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}

Analyze 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid?
The IUPAC name of 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid (CID 101494718) is 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid.
What is the SMILES notation for 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid?
The canonical SMILES for 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid is N#CC(/N=N/c1ccc(C(=O)O)cc1)c1nc2ccccc2s1.
What is the InChIKey of 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid?
The InChIKey is WXFJSIPCGHFAKE-FMQUCBEESA-N. The full InChI is InChI=1S/C16H10N4O2S/c17-9-13(15-18-12-3-1-2-4-14(12)23-15)20-19-11-7-5-10(6-8-11)16(21)22/h1-8,13H,(H,21,22)/b20-19+.
What are the key properties of 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid?
4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid has a molecular weight of 322.35 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1,3-benzothiazol-2-yl(cyano)methyl]diazenyl]benzoic acid is sourced from PubChem (CID 101494718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).