C15H24O3 — CID 101002037
[(3S,4R)-3,4-dimethyl-3-pent-4-enylcyclohexen-1-yl] methyl carbonate (PubChem CID 101002037) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is [(3S,4R)-3,4-dimethyl-3-pent-4-enylcyclohexen-1-yl] methyl carbonate.
| Compound Name | [(3S,4R)-3,4-dimethyl-3-pent-4-enylcyclohexen-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 101002037 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [(3S,4R)-3,4-dimethyl-3-pent-4-enylcyclohexen-1-yl] methyl carbonate |
| SMILES | C=CCCC[C@]1(C)C=C(OC(=O)OC)CC[C@H]1C |
| InChI | InChI=1S/C15H24O3/c1-5-6-7-10-15(3)11-13(9-8-12(15)2)18-14(16)17-4/h5,11-12H,1,6-10H2,2-4H3/t12-,15-/m1/s1 |
| InChIKey | NTEDFZCRYQULKO-IUODEOHRSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|