C14H21IO — CID 11186595
(3S,4R)-3-[(E)-4-iodo-3-methylbut-3-enyl]-3,4-dimethylcyclohexene-1-carbaldehyde (PubChem CID 11186595) has the molecular formula C14H21IO and a molecular weight of 332.23 g/mol. Its IUPAC name is (3S,4R)-3-[(E)-4-iodo-3-methylbut-3-enyl]-3,4-dimethylcyclohexene-1-carbaldehyde.
| Compound Name | (3S,4R)-3-[(E)-4-iodo-3-methylbut-3-enyl]-3,4-dimethylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 11186595 |
| Molecular Formula | C14H21IO |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (3S,4R)-3-[(E)-4-iodo-3-methylbut-3-enyl]-3,4-dimethylcyclohexene-1-carbaldehyde |
| SMILES | C/C(=C\I)CC[C@]1(C)C=C(C=O)CC[C@H]1C |
| InChI | InChI=1S/C14H21IO/c1-11(9-15)6-7-14(3)8-13(10-16)5-4-12(14)2/h8-10,12H,4-7H2,1-3H3/b11-9+/t12-,14-/m1/s1 |
| InChIKey | NKIRKSYJTRSDLP-CSJUJBHWSA-N |
| XLogP | 4.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|