C14H16O7 — CID 101002496
[(1S,7S,8S,9R,11S)-8-acetyloxy-6-oxo-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate (PubChem CID 101002496) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is [(1S,7S,8S,9R,11S)-8-acetyloxy-6-oxo-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate.
| Compound Name | [(1S,7S,8S,9R,11S)-8-acetyloxy-6-oxo-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate |
|---|---|
| PubChem CID | 101002496 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [(1S,7S,8S,9R,11S)-8-acetyloxy-6-oxo-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OCC3=CC(=O)[C@H]([C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C14H16O7/c1-6(15)18-5-10-13(20-7(2)16)12-9(17)3-8-4-19-14(21-10)11(8)12/h3,10-14H,4-5H2,1-2H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | MOONENKAIYEQFX-RGDJUOJXSA-N |
| XLogP | -0.02 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |