C16H20O8 — CID 10545090
[(1S,6S,7R,8S,9R,11S)-6,8-diacetyloxy-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate (PubChem CID 10545090) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is [(1S,6S,7R,8S,9R,11S)-6,8-diacetyloxy-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate.
| Compound Name | [(1S,6S,7R,8S,9R,11S)-6,8-diacetyloxy-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate |
|---|---|
| PubChem CID | 10545090 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(1S,6S,7R,8S,9R,11S)-6,8-diacetyloxy-2,10-dioxatricyclo[5.3.1.04,11]undec-4-en-9-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OCC3=C[C@H](OC(C)=O)[C@H]([C@@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C16H20O8/c1-7(17)20-6-12-15(23-9(3)19)14-11(22-8(2)18)4-10-5-21-16(24-12)13(10)14/h4,11-16H,5-6H2,1-3H3/t11-,12+,13+,14-,15+,16-/m0/s1 |
| InChIKey | WVIKHIAKIFZUKH-FBRBKTQXSA-N |
| XLogP | 0.34 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|