C27H19NO3 — CID 101005281
8-benzoyl-4-(2,6-dimethylphenyl)imino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one (PubChem CID 101005281) has the molecular formula C27H19NO3 and a molecular weight of 405.45 g/mol. Its IUPAC name is 8-benzoyl-4-(2,6-dimethylphenyl)imino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one.
| Compound Name | 8-benzoyl-4-(2,6-dimethylphenyl)imino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one |
|---|---|
| PubChem CID | 101005281 |
| Molecular Formula | C27H19NO3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 8-benzoyl-4-(2,6-dimethylphenyl)imino-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-one |
| SMILES | Cc1cccc(C)c1/N=C1\OC(=O)c2cccc3c(C(=O)c4ccccc4)ccc1c23 |
| InChI | InChI=1S/C27H19NO3/c1-16-8-6-9-17(2)24(16)28-26-21-15-14-20(25(29)18-10-4-3-5-11-18)19-12-7-13-22(23(19)21)27(30)31-26/h3-15H,1-2H3/b28-26- |
| InChIKey | XRLSRRZCBLESTD-SGEDCAFJSA-N |
| XLogP | 5.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|