C26H21NO2 — CID 160701546
3-benzoyl-9-pentylacenaphthyleno[1,2-b]pyrrol-8-one (PubChem CID 160701546) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-benzoyl-9-pentylacenaphthyleno[1,2-b]pyrrol-8-one.
| Compound Name | 3-benzoyl-9-pentylacenaphthyleno[1,2-b]pyrrol-8-one |
|---|---|
| PubChem CID | 160701546 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-benzoyl-9-pentylacenaphthyleno[1,2-b]pyrrol-8-one |
| SMILES | CCCCCC1=C2C(=NC1=O)c1cccc3c(C(=O)c4ccccc4)ccc2c13 |
| InChI | InChI=1S/C26H21NO2/c1-2-3-5-11-21-23-19-15-14-18(25(28)16-9-6-4-7-10-16)17-12-8-13-20(22(17)19)24(23)27-26(21)29/h4,6-10,12-15H,2-3,5,11H2,1H3 |
| InChIKey | AQIWTGRKUDDJNL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|