C21H28O3 — CID 101006066
(1S,8S,10S)-4-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-14-one (PubChem CID 101006066) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,8S,10S)-4-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-14-one.
| Compound Name | (1S,8S,10S)-4-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-14-one |
|---|---|
| PubChem CID | 101006066 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,8S,10S)-4-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-14-one |
| SMILES | COc1cc2c(cc1C(C)C)[C@@H]1C[C@H]3C(C)(C)CCC(=O)[C@]23CO1 |
| InChI | InChI=1S/C21H28O3/c1-12(2)13-8-14-15(9-16(13)23-5)21-11-24-17(14)10-18(21)20(3,4)7-6-19(21)22/h8-9,12,17-18H,6-7,10-11H2,1-5H3/t17-,18-,21+/m0/s1 |
| InChIKey | XKUCHACUVXUVER-BBTUJRGHSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |