C33H42O2Si — CID 101008857
tribenzyl-[(1S,2R,3S,4S,5R)-3,4-di(propan-2-yloxy)-2-bicyclo[3.1.0]hexanyl]silane (PubChem CID 101008857) has the molecular formula C33H42O2Si and a molecular weight of 498.78 g/mol. Its IUPAC name is tribenzyl-[(1S,2R,3S,4S,5R)-3,4-di(propan-2-yloxy)-2-bicyclo[3.1.0]hexanyl]silane.
| Compound Name | tribenzyl-[(1S,2R,3S,4S,5R)-3,4-di(propan-2-yloxy)-2-bicyclo[3.1.0]hexanyl]silane |
|---|---|
| PubChem CID | 101008857 |
| Molecular Formula | C33H42O2Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | tribenzyl-[(1S,2R,3S,4S,5R)-3,4-di(propan-2-yloxy)-2-bicyclo[3.1.0]hexanyl]silane |
| SMILES | CC(C)O[C@H]1[C@@H]2C[C@@H]2[C@@H]([Si](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)[C@H]1OC(C)C |
| InChI | InChI=1S/C33H42O2Si/c1-24(2)34-31-29-20-30(29)33(32(31)35-25(3)4)36(21-26-14-8-5-9-15-26,22-27-16-10-6-11-17-27)23-28-18-12-7-13-19-28/h5-19,24-25,29-33H,20-23H2,1-4H3/t29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | ZKCKTSNVIRMAJF-ISBPOBPSSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|