C18H18F2O6 — CID 101009555
[(2R,3S)-3-acetyloxy-6-(1,1-difluoro-2-oxo-2-phenylethyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101009555) has the molecular formula C18H18F2O6 and a molecular weight of 368.33 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-6-(1,1-difluoro-2-oxo-2-phenylethyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-acetyloxy-6-(1,1-difluoro-2-oxo-2-phenylethyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101009555 |
| Molecular Formula | C18H18F2O6 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-6-(1,1-difluoro-2-oxo-2-phenylethyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(C(F)(F)C(=O)c2ccccc2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H18F2O6/c1-11(21)24-10-15-14(25-12(2)22)8-9-16(26-15)18(19,20)17(23)13-6-4-3-5-7-13/h3-9,14-16H,10H2,1-2H3/t14-,15+,16?/m0/s1 |
| InChIKey | DXLYYIFKZUTTQA-QMRHZFGWSA-N |
| XLogP | 2.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|