C17H15NO3S — CID 101013886
2-(2-amino-4,5-dimethoxyphenyl)thiochromen-4-one (PubChem CID 101013886) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(2-amino-4,5-dimethoxyphenyl)thiochromen-4-one.
| Compound Name | 2-(2-amino-4,5-dimethoxyphenyl)thiochromen-4-one |
|---|---|
| PubChem CID | 101013886 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(2-amino-4,5-dimethoxyphenyl)thiochromen-4-one |
| SMILES | COc1cc(N)c(-c2cc(=O)c3ccccc3s2)cc1OC |
| InChI | InChI=1S/C17H15NO3S/c1-20-14-7-11(12(18)8-15(14)21-2)17-9-13(19)10-5-3-4-6-16(10)22-17/h3-9H,18H2,1-2H3 |
| InChIKey | OLHJWIIYFCEGFC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|