About (4-oxothiochromen-2-yl) thiohypoiodite
(4-oxothiochromen-2-yl) thiohypoiodite (PubChem CID 166441146) has the molecular formula C9H5IOS2
and a molecular weight of 320.18 g/mol. Its IUPAC name is (4-oxothiochromen-2-yl) thiohypoiodite.
Molecular Properties
| Compound Name | (4-oxothiochromen-2-yl) thiohypoiodite |
| PubChem CID | 166441146 |
| Molecular Formula | C9H5IOS2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | (4-oxothiochromen-2-yl) thiohypoiodite |
| SMILES | O=c1cc(SI)sc2ccccc12 |
| InChI | InChI=1S/C9H5IOS2/c10-13-9-5-7(11)6-3-1-2-4-8(6)12-9/h1-5H |
| InChIKey | FAJAWFIBBVMJSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-oxothiochromen-2-yl) thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxothiochromen-2-yl) thiohypoiodite?
The IUPAC name of (4-oxothiochromen-2-yl) thiohypoiodite (CID 166441146) is (4-oxothiochromen-2-yl) thiohypoiodite.
What is the SMILES notation for (4-oxothiochromen-2-yl) thiohypoiodite?
The canonical SMILES for (4-oxothiochromen-2-yl) thiohypoiodite is O=c1cc(SI)sc2ccccc12.
What is the InChIKey of (4-oxothiochromen-2-yl) thiohypoiodite?
The InChIKey is FAJAWFIBBVMJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5IOS2/c10-13-9-5-7(11)6-3-1-2-4-8(6)12-9/h1-5H.
What are the key properties of (4-oxothiochromen-2-yl) thiohypoiodite?
(4-oxothiochromen-2-yl) thiohypoiodite has a molecular weight of 320.18 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxothiochromen-2-yl) thiohypoiodite is sourced from PubChem (CID 166441146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).