C20H16N2OS2 — CID 166441148
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylthiochromen-4-one (PubChem CID 166441148) has the molecular formula C20H16N2OS2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylthiochromen-4-one.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylthiochromen-4-one |
|---|---|
| PubChem CID | 166441148 |
| Molecular Formula | C20H16N2OS2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylthiochromen-4-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1Sc1cc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C20H16N2OS2/c1-13-20(14(2)22(21-13)15-8-4-3-5-9-15)25-19-12-17(23)16-10-6-7-11-18(16)24-19/h3-12H,1-2H3 |
| InChIKey | NJFLYLJFXMUZGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |