C42H45N9O3 — CID 10101407
4-[3,5-bis[5-imino-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-4-yl]phenyl]-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine (PubChem CID 10101407) has the molecular formula C42H45N9O3 and a molecular weight of 723.88 g/mol. Its IUPAC name is 4-[3,5-bis[5-imino-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-4-yl]phenyl]-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine.
| Compound Name | 4-[3,5-bis[5-imino-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-4-yl]phenyl]-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine |
|---|---|
| PubChem CID | 10101407 |
| Molecular Formula | C42H45N9O3 |
| Molecular Weight | 723.88 g/mol |
| Exact Mass | 723.36 |
| IUPAC Name | 4-[3,5-bis[5-imino-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-4-yl]phenyl]-3-(4-phenylbutyl)-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine |
| SMILES | [H]/N=c1\o[n-][n+](CCCCc2ccccc2)c1-c1cc(-c2/c(=N/[H])o[n-][n+]2CCCCc2ccccc2)cc(-c2/c(=N/[H])o[n-][n+]2CCCCc2ccccc2)c1 |
| InChI | InChI=1S/C42H45N9O3/c43-40-37(49(46-52-40)25-13-10-22-31-16-4-1-5-17-31)34-28-35(38-41(44)53-47-50(38)26-14-11-23-32-18-6-2-7-19-32)30-36(29-34)39-42(45)54-48-51(39)27-15-12-24-33-20-8-3-9-21-33/h1-9,16-21,28-30,43-45H,10-15,22-27H2/b43-40-,44-41-,45-42- |
| InChIKey | RETSKUCEAXDRGP-SAIYGHIZSA-N |
| XLogP | 4.71 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|