C22H30N6O6 — CID 101014703
N-(2-acetamidoethyl)-2-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 101014703) has the molecular formula C22H30N6O6 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | N-(2-acetamidoethyl)-2-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 101014703 |
| Molecular Formula | C22H30N6O6 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CC(=O)NCCNC(=O)C(Cc1ccc(O)cc1)N(CCN)C(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N6O6/c1-14-12-27(22(34)26-20(14)32)13-19(31)28(10-7-23)18(11-16-3-5-17(30)6-4-16)21(33)25-9-8-24-15(2)29/h3-6,12,18,30H,7-11,13,23H2,1-2H3,(H,24,29)(H,25,33)(H,26,32,34) |
| InChIKey | VSRDKVDHQNZFBG-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|