C29H34N6O9 — CID 101061578
tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxo-1-phenylethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethyl]carbamate (PubChem CID 101061578) has the molecular formula C29H34N6O9 and a molecular weight of 610.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxo-1-phenylethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxo-1-phenylethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 101061578 |
| Molecular Formula | C29H34N6O9 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxo-1-phenylethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]ethyl]carbamate |
| SMILES | COc1ccc(NC(=O)C(c2ccccc2)N(CCNC(=O)OC(C)(C)C)C(=O)Cn2cc(C)c(=O)[nH]c2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H34N6O9/c1-18-16-33(27(39)32-25(18)37)17-23(36)34(14-13-30-28(40)44-29(2,3)4)24(19-9-7-6-8-10-19)26(38)31-21-12-11-20(43-5)15-22(21)35(41)42/h6-12,15-16,24H,13-14,17H2,1-5H3,(H,30,40)(H,31,38)(H,32,37,39) |
| InChIKey | GFFIODZEOVQKTQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|