C27H30N6O9 — CID 135054870
tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]phenyl]carbamate (PubChem CID 135054870) has the molecular formula C27H30N6O9 and a molecular weight of 582.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 135054870 |
| Molecular Formula | C27H30N6O9 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | tert-butyl N-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)CN(C(=O)Cn2cc(C)c(=O)[nH]c2=O)c2ccccc2NC(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N6O9/c1-16-13-31(25(37)30-24(16)36)15-23(35)32(20-9-7-6-8-18(20)29-26(38)42-27(2,3)4)14-22(34)28-19-11-10-17(41-5)12-21(19)33(39)40/h6-13H,14-15H2,1-5H3,(H,28,34)(H,29,38)(H,30,36,37) |
| InChIKey | DTFFFPMXCRWUGR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|