C31H35N9O10 — CID 136897455
benzyl N-[9-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethyl]-6-oxo-1H-purin-2-yl]carbamate (PubChem CID 136897455) has the molecular formula C31H35N9O10 and a molecular weight of 693.67 g/mol. Its IUPAC name is benzyl N-[9-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethyl]-6-oxo-1H-purin-2-yl]carbamate.
| Compound Name | benzyl N-[9-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethyl]-6-oxo-1H-purin-2-yl]carbamate |
|---|---|
| PubChem CID | 136897455 |
| Molecular Formula | C31H35N9O10 |
| Molecular Weight | 693.67 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | benzyl N-[9-[2-[[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethyl]-6-oxo-1H-purin-2-yl]carbamate |
| SMILES | COc1ccc(NC(=O)CN(CCNC(=O)OC(C)(C)C)C(=O)Cn2cnc3c(=O)[nH]c(NC(=O)OCc4ccccc4)nc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H35N9O10/c1-31(2,3)50-29(44)32-12-13-38(15-23(41)34-21-11-10-20(48-4)14-22(21)40(46)47)24(42)16-39-18-33-25-26(39)35-28(36-27(25)43)37-30(45)49-17-19-8-6-5-7-9-19/h5-11,14,18H,12-13,15-17H2,1-4H3,(H,32,44)(H,34,41)(H2,35,36,37,43,45) |
| InChIKey | LXFJBHXNAPKKSH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 242.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|