C23H34FmN7O10- — CID 167509135
fermium;2-[[3-[2-(2-methoxyethoxy)ethoxy]-2-(oxomethylamino)propyl]-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid (PubChem CID 167509135) has the molecular formula C23H34FmN7O10- and a molecular weight of 825.56 g/mol. Its IUPAC name is fermium;2-[[3-[2-(2-methoxyethoxy)ethoxy]-2-(oxomethylamino)propyl]-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid.
| Compound Name | fermium;2-[[3-[2-(2-methoxyethoxy)ethoxy]-2-(oxomethylamino)propyl]-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 167509135 |
| Molecular Formula | C23H34FmN7O10- |
| Molecular Weight | 825.56 g/mol |
| Exact Mass | 825.33 |
| IUPAC Name | fermium;2-[[3-[2-(2-methoxyethoxy)ethoxy]-2-(oxomethylamino)propyl]-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
| SMILES | COCCOCCOCC(CN(CC(=O)O)C(=O)Cn1cnc2c(=O)[nH]c(NC(=O)OC(C)(C)C)nc21)N[C-]=O.[Fm] |
| InChI | InChI=1S/C23H34N7O10.Fm/c1-23(2,3)40-22(36)28-21-26-19-18(20(35)27-21)24-13-30(19)10-16(32)29(11-17(33)34)9-15(25-14-31)12-39-8-7-38-6-5-37-4;/h13,15H,5-12H2,1-4H3,(H,25,31)(H,33,34)(H2,26,27,28,35,36);/q-1; |
| InChIKey | XXWDEFFWJLEGQO-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 216.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.56 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|