C11H16O5 — CID 101015191
3-(4-hydroxy-2,3-dimethoxyphenyl)propane-1,2-diol (PubChem CID 101015191) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 3-(4-hydroxy-2,3-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-(4-hydroxy-2,3-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 101015191 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-(4-hydroxy-2,3-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1c(O)ccc(CC(O)CO)c1OC |
| InChI | InChI=1S/C11H16O5/c1-15-10-7(5-8(13)6-12)3-4-9(14)11(10)16-2/h3-4,8,12-14H,5-6H2,1-2H3 |
| InChIKey | AZBPQNNCYSNYBF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |