C12H16O5S2 — CID 22877130
O-methyl 4-[(2R)-2,3-dihydroxypropyl]-3-methylsulfonylbenzenecarbothioate (PubChem CID 22877130) has the molecular formula C12H16O5S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is O-methyl 4-[(2R)-2,3-dihydroxypropyl]-3-methylsulfonylbenzenecarbothioate.
| Compound Name | O-methyl 4-[(2R)-2,3-dihydroxypropyl]-3-methylsulfonylbenzenecarbothioate |
|---|---|
| PubChem CID | 22877130 |
| Molecular Formula | C12H16O5S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | O-methyl 4-[(2R)-2,3-dihydroxypropyl]-3-methylsulfonylbenzenecarbothioate |
| SMILES | COC(=S)c1ccc(C[C@@H](O)CO)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H16O5S2/c1-17-12(18)9-4-3-8(5-10(14)7-13)11(6-9)19(2,15)16/h3-4,6,10,13-14H,5,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | BMCNIDVKIFBBIU-SNVBAGLBSA-N |
| XLogP | 0.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|