C35H31Cl2IN4O3 — CID 10101616
4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-ethoxy-N-[1-[[4-(3-iodobenzoyl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 10101616) has the molecular formula C35H31Cl2IN4O3 and a molecular weight of 753.47 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-ethoxy-N-[1-[[4-(3-iodobenzoyl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-ethoxy-N-[1-[[4-(3-iodobenzoyl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10101616 |
| Molecular Formula | C35H31Cl2IN4O3 |
| Molecular Weight | 753.47 g/mol |
| Exact Mass | 752.08 |
| IUPAC Name | 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-ethoxy-N-[1-[[4-(3-iodobenzoyl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | CCOc1cc(C(=O)NC2CCN(Cc3ccc(C(=O)c4cccc(I)c4)cc3)CC2)ccc1-c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C35H31Cl2IN4O3/c1-2-45-32-17-24(10-11-27(32)34-40-30-18-28(36)29(37)19-31(30)41-34)35(44)39-26-12-14-42(15-13-26)20-21-6-8-22(9-7-21)33(43)23-4-3-5-25(38)16-23/h3-11,16-19,26H,2,12-15,20H2,1H3,(H,39,44)(H,40,41) |
| InChIKey | XGILPHKUEOQLAI-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.47 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|