C4H11NO10P2 — CID 101017528
2-amino-4-hydroxy-4-phosphono-4-phosphonooxybutanoic acid (PubChem CID 101017528) has the molecular formula C4H11NO10P2 and a molecular weight of 295.08 g/mol. Its IUPAC name is 2-amino-4-hydroxy-4-phosphono-4-phosphonooxybutanoic acid.
| Compound Name | 2-amino-4-hydroxy-4-phosphono-4-phosphonooxybutanoic acid |
|---|---|
| PubChem CID | 101017528 |
| Molecular Formula | C4H11NO10P2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 2-amino-4-hydroxy-4-phosphono-4-phosphonooxybutanoic acid |
| SMILES | NC(CC(O)(OP(=O)(O)O)P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C4H11NO10P2/c5-2(3(6)7)1-4(8,16(9,10)11)15-17(12,13)14/h2,8H,1,5H2,(H,6,7)(H2,9,10,11)(H2,12,13,14) |
| InChIKey | BNYAHHOUFITZJA-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 207.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|