C6H12NO8PS — CID 137349914
(2S)-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-phosphonooxypropanoic acid (PubChem CID 137349914) has the molecular formula C6H12NO8PS and a molecular weight of 289.20 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-phosphonooxypropanoic acid.
| Compound Name | (2S)-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-phosphonooxypropanoic acid |
|---|---|
| PubChem CID | 137349914 |
| Molecular Formula | C6H12NO8PS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (2S)-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-phosphonooxypropanoic acid |
| SMILES | C[C@](OP(=O)(O)O)(SC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12NO8PS/c1-6(5(10)11,15-16(12,13)14)17-2-3(7)4(8)9/h3H,2,7H2,1H3,(H,8,9)(H,10,11)(H2,12,13,14)/t3-,6-/m0/s1 |
| InChIKey | SOTXSLHXKDYAQY-DZSWIPIPSA-N |
| XLogP | -0.96 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|