C23H44O2Si — CID 101018809
1-heptyl-3-hexyl-5-(2-hydroxyethyl)-2-trimethylsilylcyclopenta-2,4-dien-1-ol (PubChem CID 101018809) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is 1-heptyl-3-hexyl-5-(2-hydroxyethyl)-2-trimethylsilylcyclopenta-2,4-dien-1-ol.
| Compound Name | 1-heptyl-3-hexyl-5-(2-hydroxyethyl)-2-trimethylsilylcyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 101018809 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 1-heptyl-3-hexyl-5-(2-hydroxyethyl)-2-trimethylsilylcyclopenta-2,4-dien-1-ol |
| SMILES | CCCCCCCC1(O)C(CCO)=CC(CCCCCC)=C1[Si](C)(C)C |
| InChI | InChI=1S/C23H44O2Si/c1-6-8-10-12-14-17-23(25)21(16-18-24)19-20(15-13-11-9-7-2)22(23)26(3,4)5/h19,24-25H,6-18H2,1-5H3 |
| InChIKey | QHBPSWFDAXGBGD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|