C18H32N2O3S — CID 101170696
5-dodecyl-5-hydroxy-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 101170696) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is 5-dodecyl-5-hydroxy-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-dodecyl-5-hydroxy-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 101170696 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 5-dodecyl-5-hydroxy-1,3-dimethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCCCCCCCCCC1(O)C(=O)N(C)C(=S)N(C)C1=O |
| InChI | InChI=1S/C18H32N2O3S/c1-4-5-6-7-8-9-10-11-12-13-14-18(23)15(21)19(2)17(24)20(3)16(18)22/h23H,4-14H2,1-3H3 |
| InChIKey | OYRKLPBVLQLZPW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|