C48H94N2O3 — CID 163625566
4-hydroxy-3,3,5,5-tetra(nonyl)-1-octylpiperazine-2,6-dione (PubChem CID 163625566) has the molecular formula C48H94N2O3 and a molecular weight of 747.29 g/mol. Its IUPAC name is 4-hydroxy-3,3,5,5-tetra(nonyl)-1-octylpiperazine-2,6-dione.
| Compound Name | 4-hydroxy-3,3,5,5-tetra(nonyl)-1-octylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 163625566 |
| Molecular Formula | C48H94N2O3 |
| Molecular Weight | 747.29 g/mol |
| Exact Mass | 746.73 |
| IUPAC Name | 4-hydroxy-3,3,5,5-tetra(nonyl)-1-octylpiperazine-2,6-dione |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)C(=O)N(CCCCCCCC)C(=O)C(CCCCCCCCC)(CCCCCCCCC)N1O |
| InChI | InChI=1S/C48H94N2O3/c1-6-11-16-21-26-30-35-40-47(41-36-31-27-22-17-12-7-2)45(51)49(44-39-34-25-20-15-10-5)46(52)48(50(47)53,42-37-32-28-23-18-13-8-3)43-38-33-29-24-19-14-9-4/h53H,6-44H2,1-5H3 |
| InChIKey | HRSFAJPBGJSDNC-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.29 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|