C16H29NO2S — CID 87207528
1,3-dihexyl-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 87207528) has the molecular formula C16H29NO2S and a molecular weight of 299.48 g/mol. Its IUPAC name is 1,3-dihexyl-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1,3-dihexyl-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87207528 |
| Molecular Formula | C16H29NO2S |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1,3-dihexyl-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CCCCCCN1C(=O)CC(S)(CCCCCC)C1=O |
| InChI | InChI=1S/C16H29NO2S/c1-3-5-7-9-11-16(20)13-14(18)17(15(16)19)12-10-8-6-4-2/h20H,3-13H2,1-2H3 |
| InChIKey | ZUQMXKGKVCDKDM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|