C14H26N2O4 — CID 21324143
5-hexyl-1,3-bis(2-hydroxyethyl)-5-methylimidazolidine-2,4-dione (PubChem CID 21324143) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is 5-hexyl-1,3-bis(2-hydroxyethyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-hexyl-1,3-bis(2-hydroxyethyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21324143 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 5-hexyl-1,3-bis(2-hydroxyethyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCCC1(C)C(=O)N(CCO)C(=O)N1CCO |
| InChI | InChI=1S/C14H26N2O4/c1-3-4-5-6-7-14(2)12(19)15(8-10-17)13(20)16(14)9-11-18/h17-18H,3-11H2,1-2H3 |
| InChIKey | UVPPVRBYVKTAIW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|