C15H28N2O8S2 — CID 22754387
1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione;bis(3-sulfanylpropanoic acid) (PubChem CID 22754387) has the molecular formula C15H28N2O8S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione;bis(3-sulfanylpropanoic acid).
| Compound Name | 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione;bis(3-sulfanylpropanoic acid) |
|---|---|
| PubChem CID | 22754387 |
| Molecular Formula | C15H28N2O8S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione;bis(3-sulfanylpropanoic acid) |
| SMILES | CC1(C)C(=O)N(CCO)C(=O)N1CCO.O=C(O)CCS.O=C(O)CCS |
| InChI | InChI=1S/C9H16N2O4.2C3H6O2S/c1-9(2)7(14)10(3-5-12)8(15)11(9)4-6-13;2*4-3(5)1-2-6/h12-13H,3-6H2,1-2H3;2*6H,1-2H2,(H,4,5) |
| InChIKey | FOIPVGOOCQJFIP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|